C21H16Cl2N2O3 — CID 2373568
[2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2-(4-phenylphenyl)acetate (PubChem CID 2373568) has the molecular formula C21H16Cl2N2O3 and a molecular weight of 415.28 g/mol. Its IUPAC name is [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2-(4-phenylphenyl)acetate.
| Compound Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2-(4-phenylphenyl)acetate |
|---|---|
| PubChem CID | 2373568 |
| Molecular Formula | C21H16Cl2N2O3 |
| Molecular Weight | 415.28 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 2-(4-phenylphenyl)acetate |
| SMILES | O=C(COC(=O)Cc1ccc(-c2ccccc2)cc1)Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C21H16Cl2N2O3/c22-17-11-18(23)21(24-12-17)25-19(26)13-28-20(27)10-14-6-8-16(9-7-14)15-4-2-1-3-5-15/h1-9,11-12H,10,13H2,(H,24,25,26) |
| InChIKey | HWRSSQYFTBMRIE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.28 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |