C18H13Cl2N3O5 — CID 3913836
[2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 3913836) has the molecular formula C18H13Cl2N3O5 and a molecular weight of 422.22 g/mol. Its IUPAC name is [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 3913836 |
| Molecular Formula | C18H13Cl2N3O5 |
| Molecular Weight | 422.22 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 3-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | O=C(COC(=O)CCN1C(=O)c2ccccc2C1=O)Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C18H13Cl2N3O5/c19-10-7-13(20)16(21-8-10)22-14(24)9-28-15(25)5-6-23-17(26)11-3-1-2-4-12(11)18(23)27/h1-4,7-8H,5-6,9H2,(H,21,22,24) |
| InChIKey | OKULEZKCQJINOP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.22 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|