C18H18Cl2N2O4 — CID 7148014
[2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 4-(3-methylphenoxy)butanoate (PubChem CID 7148014) has the molecular formula C18H18Cl2N2O4 and a molecular weight of 397.26 g/mol. Its IUPAC name is [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 4-(3-methylphenoxy)butanoate.
| Compound Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 4-(3-methylphenoxy)butanoate |
|---|---|
| PubChem CID | 7148014 |
| Molecular Formula | C18H18Cl2N2O4 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 4-(3-methylphenoxy)butanoate |
| SMILES | Cc1cccc(OCCCC(=O)OCC(=O)Nc2ncc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C18H18Cl2N2O4/c1-12-4-2-5-14(8-12)25-7-3-6-17(24)26-11-16(23)22-18-15(20)9-13(19)10-21-18/h2,4-5,8-10H,3,6-7,11H2,1H3,(H,21,22,23) |
| InChIKey | GRGVWLAKNIPZJE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|