C11H15Cl2N3OS — CID 66234835
2-(3-aminobutylsulfanyl)-N-(3,5-dichloro-2-pyridinyl)acetamide (PubChem CID 66234835) has the molecular formula C11H15Cl2N3OS and a molecular weight of 308.23 g/mol. Its IUPAC name is 2-(3-aminobutylsulfanyl)-N-(3,5-dichloro-2-pyridinyl)acetamide.
| Compound Name | 2-(3-aminobutylsulfanyl)-N-(3,5-dichloro-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 66234835 |
| Molecular Formula | C11H15Cl2N3OS |
| Molecular Weight | 308.23 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 2-(3-aminobutylsulfanyl)-N-(3,5-dichloro-2-pyridinyl)acetamide |
| SMILES | CC(N)CCSCC(=O)Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C11H15Cl2N3OS/c1-7(14)2-3-18-6-10(17)16-11-9(13)4-8(12)5-15-11/h4-5,7H,2-3,6,14H2,1H3,(H,15,16,17) |
| InChIKey | PZJRQBHALVDCJD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.23 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|