C12H16F3N3O2 — CID 102717921
methyl 2-[[6-(ethylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]propanoate (PubChem CID 102717921) has the molecular formula C12H16F3N3O2 and a molecular weight of 291.27 g/mol. Its IUPAC name is methyl 2-[[6-(ethylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]propanoate.
| Compound Name | methyl 2-[[6-(ethylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]propanoate |
|---|---|
| PubChem CID | 102717921 |
| Molecular Formula | C12H16F3N3O2 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | methyl 2-[[6-(ethylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]propanoate |
| SMILES | CCNc1cc(C(F)(F)F)cc(NC(C)C(=O)OC)n1 |
| InChI | InChI=1S/C12H16F3N3O2/c1-4-16-9-5-8(12(13,14)15)6-10(18-9)17-7(2)11(19)20-3/h5-7H,4H2,1-3H3,(H2,16,17,18) |
| InChIKey | QCEFQDNPNHLPBH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |