C12H6Br2ClF3N2 — CID 102715636
6-chloro-N-(2,4-dibromophenyl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102715636) has the molecular formula C12H6Br2ClF3N2 and a molecular weight of 430.45 g/mol. Its IUPAC name is 6-chloro-N-(2,4-dibromophenyl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-chloro-N-(2,4-dibromophenyl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102715636 |
| Molecular Formula | C12H6Br2ClF3N2 |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 427.85 |
| IUPAC Name | 6-chloro-N-(2,4-dibromophenyl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1cc(Cl)nc(Nc2ccc(Br)cc2Br)c1 |
| InChI | InChI=1S/C12H6Br2ClF3N2/c13-7-1-2-9(8(14)5-7)19-11-4-6(12(16,17)18)3-10(15)20-11/h1-5H,(H,19,20) |
| InChIKey | HWQWQGHCCHEGGI-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|