C12H6BrClF4N2 — CID 107637179
N-(2-bromo-5-fluorophenyl)-6-chloro-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 107637179) has the molecular formula C12H6BrClF4N2 and a molecular weight of 369.54 g/mol. Its IUPAC name is N-(2-bromo-5-fluorophenyl)-6-chloro-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-(2-bromo-5-fluorophenyl)-6-chloro-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 107637179 |
| Molecular Formula | C12H6BrClF4N2 |
| Molecular Weight | 369.54 g/mol |
| Exact Mass | 367.93 |
| IUPAC Name | N-(2-bromo-5-fluorophenyl)-6-chloro-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | Fc1ccc(Br)c(Nc2cc(C(F)(F)F)cc(Cl)n2)c1 |
| InChI | InChI=1S/C12H6BrClF4N2/c13-8-2-1-7(15)5-9(8)19-11-4-6(12(16,17)18)3-10(14)20-11/h1-5H,(H,19,20) |
| InChIKey | AYPWEIIQCDJLTM-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|