C13H12BrF3N4 — CID 102721054
N-(2-bromo-5-methylphenyl)-6-hydrazinyl-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102721054) has the molecular formula C13H12BrF3N4 and a molecular weight of 361.17 g/mol. Its IUPAC name is N-(2-bromo-5-methylphenyl)-6-hydrazinyl-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-(2-bromo-5-methylphenyl)-6-hydrazinyl-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102721054 |
| Molecular Formula | C13H12BrF3N4 |
| Molecular Weight | 361.17 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | N-(2-bromo-5-methylphenyl)-6-hydrazinyl-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | Cc1ccc(Br)c(Nc2cc(C(F)(F)F)cc(NN)n2)c1 |
| InChI | InChI=1S/C13H12BrF3N4/c1-7-2-3-9(14)10(4-7)19-11-5-8(13(15,16)17)6-12(20-11)21-18/h2-6H,18H2,1H3,(H2,19,20,21) |
| InChIKey | NBVZNFAUWUDVBN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.17 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|