C21H21F5N6O4 — CID 155687528
[2-(difluoromethyl)-4-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-morpholin-4-ylmethanone (PubChem CID 155687528) has the molecular formula C21H21F5N6O4 and a molecular weight of 516.43 g/mol. Its IUPAC name is [2-(difluoromethyl)-4-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-morpholin-4-ylmethanone.
| Compound Name | [2-(difluoromethyl)-4-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 155687528 |
| Molecular Formula | C21H21F5N6O4 |
| Molecular Weight | 516.43 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | [2-(difluoromethyl)-4-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-morpholin-4-ylmethanone |
| SMILES | C[C@@H](Nc1nc(C(F)F)nc2c1CN(C(=O)N1CCOCC1)C2)c1cc([N+](=O)[O-])cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H21F5N6O4/c1-11(12-6-13(21(24,25)26)8-14(7-12)32(34)35)27-18-15-9-31(20(33)30-2-4-36-5-3-30)10-16(15)28-19(29-18)17(22)23/h6-8,11,17H,2-5,9-10H2,1H3,(H,27,28,29)/t11-/m1/s1 |
| InChIKey | NMMTVZFHCNJMLN-LLVKDONJSA-N |
| XLogP | 4.28 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|