C19H19ClF3N5O4 — CID 166476469
tert-butyl 2-chloro-4-[[3-nitro-5-(trifluoromethyl)phenyl]methylamino]-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate (PubChem CID 166476469) has the molecular formula C19H19ClF3N5O4 and a molecular weight of 473.84 g/mol. Its IUPAC name is tert-butyl 2-chloro-4-[[3-nitro-5-(trifluoromethyl)phenyl]methylamino]-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate.
| Compound Name | tert-butyl 2-chloro-4-[[3-nitro-5-(trifluoromethyl)phenyl]methylamino]-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 166476469 |
| Molecular Formula | C19H19ClF3N5O4 |
| Molecular Weight | 473.84 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | tert-butyl 2-chloro-4-[[3-nitro-5-(trifluoromethyl)phenyl]methylamino]-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1Cc2nc(Cl)nc(NCc3cc([N+](=O)[O-])cc(C(F)(F)F)c3)c2C1 |
| InChI | InChI=1S/C19H19ClF3N5O4/c1-18(2,3)32-17(29)27-8-13-14(9-27)25-16(20)26-15(13)24-7-10-4-11(19(21,22)23)6-12(5-10)28(30)31/h4-6H,7-9H2,1-3H3,(H,24,25,26) |
| InChIKey | PRJFIUCGKDVJEF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.84 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|