C22H23F3N6O4 — CID 166476603
[2-(2-hydroxyethylamino)-4-[[3-nitro-5-(trifluoromethyl)phenyl]methylamino]-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-(3-methylidenecyclobutyl)methanone (PubChem CID 166476603) has the molecular formula C22H23F3N6O4 and a molecular weight of 492.46 g/mol. Its IUPAC name is [2-(2-hydroxyethylamino)-4-[[3-nitro-5-(trifluoromethyl)phenyl]methylamino]-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-(3-methylidenecyclobutyl)methanone.
| Compound Name | [2-(2-hydroxyethylamino)-4-[[3-nitro-5-(trifluoromethyl)phenyl]methylamino]-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-(3-methylidenecyclobutyl)methanone |
|---|---|
| PubChem CID | 166476603 |
| Molecular Formula | C22H23F3N6O4 |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | [2-(2-hydroxyethylamino)-4-[[3-nitro-5-(trifluoromethyl)phenyl]methylamino]-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-(3-methylidenecyclobutyl)methanone |
| SMILES | C=C1CC(C(=O)N2Cc3nc(NCCO)nc(NCc4cc([N+](=O)[O-])cc(C(F)(F)F)c4)c3C2)C1 |
| InChI | InChI=1S/C22H23F3N6O4/c1-12-4-14(5-12)20(33)30-10-17-18(11-30)28-21(26-2-3-32)29-19(17)27-9-13-6-15(22(23,24)25)8-16(7-13)31(34)35/h6-8,14,32H,1-5,9-11H2,(H2,26,27,28,29) |
| InChIKey | UOJRGUPQJKDKQB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|