C20H17F3N4O4 — CID 170107208
2-ethenyl-6,7-dimethoxy-N-[[3-nitro-5-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine (PubChem CID 170107208) has the molecular formula C20H17F3N4O4 and a molecular weight of 434.37 g/mol. Its IUPAC name is 2-ethenyl-6,7-dimethoxy-N-[[3-nitro-5-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine.
| Compound Name | 2-ethenyl-6,7-dimethoxy-N-[[3-nitro-5-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 170107208 |
| Molecular Formula | C20H17F3N4O4 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 2-ethenyl-6,7-dimethoxy-N-[[3-nitro-5-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine |
| SMILES | C=Cc1nc(NCc2cc([N+](=O)[O-])cc(C(F)(F)F)c2)c2cc(OC)c(OC)cc2n1 |
| InChI | InChI=1S/C20H17F3N4O4/c1-4-18-25-15-9-17(31-3)16(30-2)8-14(15)19(26-18)24-10-11-5-12(20(21,22)23)7-13(6-11)27(28)29/h4-9H,1,10H2,2-3H3,(H,24,25,26) |
| InChIKey | SEXLFJLJYBQSBN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|