C22H22F6N6O2 — CID 155524716
2-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-N-[3-(dimethylamino)propyl]-6-nitroquinoxaline-2,3-diamine (PubChem CID 155524716) has the molecular formula C22H22F6N6O2 and a molecular weight of 516.45 g/mol. Its IUPAC name is 2-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-N-[3-(dimethylamino)propyl]-6-nitroquinoxaline-2,3-diamine.
| Compound Name | 2-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-N-[3-(dimethylamino)propyl]-6-nitroquinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 155524716 |
| Molecular Formula | C22H22F6N6O2 |
| Molecular Weight | 516.45 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | 2-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-N-[3-(dimethylamino)propyl]-6-nitroquinoxaline-2,3-diamine |
| SMILES | CN(C)CCCNc1nc2cc([N+](=O)[O-])ccc2nc1NCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H22F6N6O2/c1-33(2)7-3-6-29-19-20(31-17-5-4-16(34(35)36)11-18(17)32-19)30-12-13-8-14(21(23,24)25)10-15(9-13)22(26,27)28/h4-5,8-11H,3,6-7,12H2,1-2H3,(H,29,32)(H,30,31) |
| InChIKey | QNUISROSFPHTFD-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.45 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|