C16H11BrF6N2O2 — CID 86615393
1-[3,5-bis(trifluoromethyl)phenyl]-N-[(2-bromo-5-nitrophenyl)methyl]methanamine (PubChem CID 86615393) has the molecular formula C16H11BrF6N2O2 and a molecular weight of 457.17 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-N-[(2-bromo-5-nitrophenyl)methyl]methanamine.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-N-[(2-bromo-5-nitrophenyl)methyl]methanamine |
|---|---|
| PubChem CID | 86615393 |
| Molecular Formula | C16H11BrF6N2O2 |
| Molecular Weight | 457.17 g/mol |
| Exact Mass | 455.99 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-N-[(2-bromo-5-nitrophenyl)methyl]methanamine |
| SMILES | O=[N+]([O-])c1ccc(Br)c(CNCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C16H11BrF6N2O2/c17-14-2-1-13(25(26)27)5-10(14)8-24-7-9-3-11(15(18,19)20)6-12(4-9)16(21,22)23/h1-6,24H,7-8H2 |
| InChIKey | OJUMYQUOPPCXPA-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.17 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|