C19H13BrF6N2O4 — CID 87121643
(4S)-5-[3,5-bis(trifluoromethyl)phenyl]-3-[(2-bromo-5-nitrophenyl)methyl]-4-methyl-1,3-oxazolidin-2-one (PubChem CID 87121643) has the molecular formula C19H13BrF6N2O4 and a molecular weight of 527.22 g/mol. Its IUPAC name is (4S)-5-[3,5-bis(trifluoromethyl)phenyl]-3-[(2-bromo-5-nitrophenyl)methyl]-4-methyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-5-[3,5-bis(trifluoromethyl)phenyl]-3-[(2-bromo-5-nitrophenyl)methyl]-4-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 87121643 |
| Molecular Formula | C19H13BrF6N2O4 |
| Molecular Weight | 527.22 g/mol |
| Exact Mass | 526.00 |
| IUPAC Name | (4S)-5-[3,5-bis(trifluoromethyl)phenyl]-3-[(2-bromo-5-nitrophenyl)methyl]-4-methyl-1,3-oxazolidin-2-one |
| SMILES | C[C@H]1C(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)OC(=O)N1Cc1cc([N+](=O)[O-])ccc1Br |
| InChI | InChI=1S/C19H13BrF6N2O4/c1-9-16(10-4-12(18(21,22)23)7-13(5-10)19(24,25)26)32-17(29)27(9)8-11-6-14(28(30)31)2-3-15(11)20/h2-7,9,16H,8H2,1H3/t9-,16?/m0/s1 |
| InChIKey | LEWSYCDKXDAEOU-XUOZKRPMSA-N |
| XLogP | 6.48 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.22 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|