C25H22F9NO2Si — CID 162607211
(4S)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-3-[[5-(trifluoromethyl)-2-(2-trimethylsilylethynyl)phenyl]methyl]-1,3-oxazolidin-2-one (PubChem CID 162607211) has the molecular formula C25H22F9NO2Si and a molecular weight of 567.52 g/mol. Its IUPAC name is (4S)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-3-[[5-(trifluoromethyl)-2-(2-trimethylsilylethynyl)phenyl]methyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-3-[[5-(trifluoromethyl)-2-(2-trimethylsilylethynyl)phenyl]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 162607211 |
| Molecular Formula | C25H22F9NO2Si |
| Molecular Weight | 567.52 g/mol |
| Exact Mass | 567.13 |
| IUPAC Name | (4S)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-3-[[5-(trifluoromethyl)-2-(2-trimethylsilylethynyl)phenyl]methyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@H]1C(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)OC(=O)N1Cc1cc(C(F)(F)F)ccc1C#C[Si](C)(C)C |
| InChI | InChI=1S/C25H22F9NO2Si/c1-14-21(16-9-19(24(29,30)31)12-20(10-16)25(32,33)34)37-22(36)35(14)13-17-11-18(23(26,27)28)6-5-15(17)7-8-38(2,3)4/h5-6,9-12,14,21H,13H2,1-4H3/t14-,21?/m0/s1 |
| InChIKey | TZEBVSPYYQRICX-YXWRBFHGSA-N |
| XLogP | 8.05 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.52 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|