C26H26BF9NO4+ — CID 163702453
(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-3-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-1-ium-2-yl)-5-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidin-2-one (PubChem CID 163702453) has the molecular formula C26H26BF9NO4+ and a molecular weight of 598.29 g/mol. Its IUPAC name is (4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-3-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-1-ium-2-yl)-5-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-3-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-1-ium-2-yl)-5-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 163702453 |
| Molecular Formula | C26H26BF9NO4+ |
| Molecular Weight | 598.29 g/mol |
| Exact Mass | 598.18 |
| IUPAC Name | (4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-3-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-1-ium-2-yl)-5-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@H]1[C@@H](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)OC(=O)N1Cc1cc(C(F)(F)F)ccc1B1OC(C)(C)C(C)(C)[OH+]1 |
| InChI | InChI=1S/C26H25BF9NO4/c1-13-20(14-8-17(25(31,32)33)11-18(9-14)26(34,35)36)39-21(38)37(13)12-15-10-16(24(28,29)30)6-7-19(15)27-40-22(2,3)23(4,5)41-27/h6-11,13,20H,12H2,1-5H3/p+1/t13-,20-/m0/s1 |
| InChIKey | KCFASYVWGBLSMC-RBZFPXEDSA-O |
| XLogP | 6.64 |
| TPSA | 51.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.29 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|