C27H34BF6NO4 — CID 144677484
5-[3,5-bis(trifluoromethyl)phenyl]-3-[[5,5-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexen-1-yl]methyl]-4-methyl-1,3-oxazolidin-2-one (PubChem CID 144677484) has the molecular formula C27H34BF6NO4 and a molecular weight of 561.37 g/mol. Its IUPAC name is 5-[3,5-bis(trifluoromethyl)phenyl]-3-[[5,5-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexen-1-yl]methyl]-4-methyl-1,3-oxazolidin-2-one.
| Compound Name | 5-[3,5-bis(trifluoromethyl)phenyl]-3-[[5,5-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexen-1-yl]methyl]-4-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 144677484 |
| Molecular Formula | C27H34BF6NO4 |
| Molecular Weight | 561.37 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | 5-[3,5-bis(trifluoromethyl)phenyl]-3-[[5,5-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexen-1-yl]methyl]-4-methyl-1,3-oxazolidin-2-one |
| SMILES | CC1C(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)OC(=O)N1CC1=C(B2OC(C)(C)C(C)(C)O2)CCC(C)(C)C1 |
| InChI | InChI=1S/C27H34BF6NO4/c1-15-21(16-10-18(26(29,30)31)12-19(11-16)27(32,33)34)37-22(36)35(15)14-17-13-23(2,3)9-8-20(17)28-38-24(4,5)25(6,7)39-28/h10-12,15,21H,8-9,13-14H2,1-7H3 |
| InChIKey | OONYSVBNNOGYNT-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.37 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|