C32H35F9N2O3 — CID 89052483
(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-3-[[2-[2-methoxy-5-[methyl(1,1,1-trifluoropropan-2-yl)amino]phenyl]-5,5-dimethylcyclohexen-1-yl]methyl]-4-methyl-1,3-oxazolidin-2-one (PubChem CID 89052483) has the molecular formula C32H35F9N2O3 and a molecular weight of 666.63 g/mol. Its IUPAC name is (4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-3-[[2-[2-methoxy-5-[methyl(1,1,1-trifluoropropan-2-yl)amino]phenyl]-5,5-dimethylcyclohexen-1-yl]methyl]-4-methyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-3-[[2-[2-methoxy-5-[methyl(1,1,1-trifluoropropan-2-yl)amino]phenyl]-5,5-dimethylcyclohexen-1-yl]methyl]-4-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 89052483 |
| Molecular Formula | C32H35F9N2O3 |
| Molecular Weight | 666.63 g/mol |
| Exact Mass | 666.25 |
| IUPAC Name | (4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-3-[[2-[2-methoxy-5-[methyl(1,1,1-trifluoropropan-2-yl)amino]phenyl]-5,5-dimethylcyclohexen-1-yl]methyl]-4-methyl-1,3-oxazolidin-2-one |
| SMILES | COc1ccc(N(C)C(C)C(F)(F)F)cc1C1=C(CN2C(=O)O[C@H](c3cc(C(F)(F)F)cc(C(F)(F)F)c3)[C@@H]2C)CC(C)(C)CC1 |
| InChI | InChI=1S/C32H35F9N2O3/c1-17-27(19-11-21(31(36,37)38)13-22(12-19)32(39,40)41)46-28(44)43(17)16-20-15-29(3,4)10-9-24(20)25-14-23(7-8-26(25)45-6)42(5)18(2)30(33,34)35/h7-8,11-14,17-18,27H,9-10,15-16H2,1-6H3/t17-,18?,27-/m0/s1 |
| InChIKey | QTKIWIJXJKYLDU-RWSLIWHUSA-N |
| XLogP | 9.67 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.63 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|