C35H31F8NO5 — CID 90317404
4-[3-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-4-methoxyphenyl]-3,5-difluorobenzoic acid (PubChem CID 90317404) has the molecular formula C35H31F8NO5 and a molecular weight of 697.62 g/mol. Its IUPAC name is 4-[3-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-4-methoxyphenyl]-3,5-difluorobenzoic acid.
| Compound Name | 4-[3-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-4-methoxyphenyl]-3,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 90317404 |
| Molecular Formula | C35H31F8NO5 |
| Molecular Weight | 697.62 g/mol |
| Exact Mass | 697.21 |
| IUPAC Name | 4-[3-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-4-methoxyphenyl]-3,5-difluorobenzoic acid |
| SMILES | COc1ccc(-c2c(F)cc(C(=O)O)cc2F)cc1C1=C(CN2C(=O)O[C@H](c3cc(C(F)(F)F)cc(C(F)(F)F)c3)[C@@H]2C)CC(C)(C)CC1 |
| InChI | InChI=1S/C35H31F8NO5/c1-17-30(19-9-22(34(38,39)40)14-23(10-19)35(41,42)43)49-32(47)44(17)16-21-15-33(2,3)8-7-24(21)25-11-18(5-6-28(25)48-4)29-26(36)12-20(31(45)46)13-27(29)37/h5-6,9-14,17,30H,7-8,15-16H2,1-4H3,(H,45,46)/t17-,30-/m0/s1 |
| InChIKey | LJNLOXFAJIBKKX-ZOKDDAQRSA-N |
| XLogP | 9.92 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.62 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |