C35H29F10NO4 — CID 90317347
4-[3-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-5-(trifluoromethyl)phenyl]-3-fluorobenzoic acid (PubChem CID 90317347) has the molecular formula C35H29F10NO4 and a molecular weight of 717.60 g/mol. Its IUPAC name is 4-[3-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-5-(trifluoromethyl)phenyl]-3-fluorobenzoic acid.
| Compound Name | 4-[3-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-5-(trifluoromethyl)phenyl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 90317347 |
| Molecular Formula | C35H29F10NO4 |
| Molecular Weight | 717.60 g/mol |
| Exact Mass | 717.19 |
| IUPAC Name | 4-[3-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-5-(trifluoromethyl)phenyl]-3-fluorobenzoic acid |
| SMILES | C[C@H]1[C@@H](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)OC(=O)N1CC1=C(c2cc(-c3ccc(C(=O)O)cc3F)cc(C(F)(F)F)c2)CCC(C)(C)C1 |
| InChI | InChI=1S/C35H29F10NO4/c1-17-29(21-11-24(34(40,41)42)14-25(12-21)35(43,44)45)50-31(49)46(17)16-22-15-32(2,3)7-6-26(22)19-8-20(10-23(9-19)33(37,38)39)27-5-4-18(30(47)48)13-28(27)36/h4-5,8-14,17,29H,6-7,15-16H2,1-3H3,(H,47,48)/t17-,29-/m0/s1 |
| InChIKey | BVBOMNZUFPSKLU-ADKRDUOOSA-N |
| XLogP | 10.79 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.60 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |