C23H23F4N4O4Si — CID 174104372
CID 174104372 (PubChem CID 174104372) has the molecular formula C23H23F4N4O4Si and a molecular weight of 523.54 g/mol.
| Compound Name | CID 174104372 |
|---|---|
| PubChem CID | 174104372 |
| Molecular Formula | C23H23F4N4O4Si |
| Molecular Weight | 523.54 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | — |
| SMILES | COc1cc2nc(C)nc(NCc3cc(F)cc(C(F)(F)F)c3)c2cc1OC[Si]1CN(C)C(=O)CO1 |
| InChI | InChI=1S/C23H23F4N4O4Si/c1-13-29-18-8-19(33-3)20(34-12-36-11-31(2)21(32)10-35-36)7-17(18)22(30-13)28-9-14-4-15(23(25,26)27)6-16(24)5-14/h4-8H,9-12H2,1-3H3,(H,28,29,30) |
| InChIKey | XQXLOKLHBHPNEC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|