C13H17F2NO4S — CID 43431089
methyl 2-[(2,6-difluorophenyl)sulfonylamino]-2-methylpentanoate (PubChem CID 43431089) has the molecular formula C13H17F2NO4S and a molecular weight of 321.35 g/mol. Its IUPAC name is methyl 2-[(2,6-difluorophenyl)sulfonylamino]-2-methylpentanoate.
| Compound Name | methyl 2-[(2,6-difluorophenyl)sulfonylamino]-2-methylpentanoate |
|---|---|
| PubChem CID | 43431089 |
| Molecular Formula | C13H17F2NO4S |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | methyl 2-[(2,6-difluorophenyl)sulfonylamino]-2-methylpentanoate |
| SMILES | CCCC(C)(NS(=O)(=O)c1c(F)cccc1F)C(=O)OC |
| InChI | InChI=1S/C13H17F2NO4S/c1-4-8-13(2,12(17)20-3)16-21(18,19)11-9(14)6-5-7-10(11)15/h5-7,16H,4,8H2,1-3H3 |
| InChIKey | KYPKMARUYZUVJX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |