C13H17ClFNO4S — CID 43431070
methyl 2-[(2-chloro-4-fluorophenyl)sulfonylamino]-2-methylpentanoate (PubChem CID 43431070) has the molecular formula C13H17ClFNO4S and a molecular weight of 337.80 g/mol. Its IUPAC name is methyl 2-[(2-chloro-4-fluorophenyl)sulfonylamino]-2-methylpentanoate.
| Compound Name | methyl 2-[(2-chloro-4-fluorophenyl)sulfonylamino]-2-methylpentanoate |
|---|---|
| PubChem CID | 43431070 |
| Molecular Formula | C13H17ClFNO4S |
| Molecular Weight | 337.80 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | methyl 2-[(2-chloro-4-fluorophenyl)sulfonylamino]-2-methylpentanoate |
| SMILES | CCCC(C)(NS(=O)(=O)c1ccc(F)cc1Cl)C(=O)OC |
| InChI | InChI=1S/C13H17ClFNO4S/c1-4-7-13(2,12(17)20-3)16-21(18,19)11-6-5-9(15)8-10(11)14/h5-6,8,16H,4,7H2,1-3H3 |
| InChIKey | JTIGPVKDWXMVER-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.80 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |