C12H16ClNO4S — CID 79793090
2-[(2-chloro-4-methylphenyl)sulfonylamino]-2-methylbutanoic acid (PubChem CID 79793090) has the molecular formula C12H16ClNO4S and a molecular weight of 305.78 g/mol. Its IUPAC name is 2-[(2-chloro-4-methylphenyl)sulfonylamino]-2-methylbutanoic acid.
| Compound Name | 2-[(2-chloro-4-methylphenyl)sulfonylamino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 79793090 |
| Molecular Formula | C12H16ClNO4S |
| Molecular Weight | 305.78 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 2-[(2-chloro-4-methylphenyl)sulfonylamino]-2-methylbutanoic acid |
| SMILES | CCC(C)(NS(=O)(=O)c1ccc(C)cc1Cl)C(=O)O |
| InChI | InChI=1S/C12H16ClNO4S/c1-4-12(3,11(15)16)14-19(17,18)10-6-5-8(2)7-9(10)13/h5-7,14H,4H2,1-3H3,(H,15,16) |
| InChIKey | UFVXQEGLMFRRSR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.78 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |