C11H15ClN2O3S — CID 24629157
N'-(2-chloro-4-methylphenyl)sulfonyl-2-methylpropanehydrazide (PubChem CID 24629157) has the molecular formula C11H15ClN2O3S and a molecular weight of 290.77 g/mol. Its IUPAC name is N'-(2-chloro-4-methylphenyl)sulfonyl-2-methylpropanehydrazide.
| Compound Name | N'-(2-chloro-4-methylphenyl)sulfonyl-2-methylpropanehydrazide |
|---|---|
| PubChem CID | 24629157 |
| Molecular Formula | C11H15ClN2O3S |
| Molecular Weight | 290.77 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | N'-(2-chloro-4-methylphenyl)sulfonyl-2-methylpropanehydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNC(=O)C(C)C)c(Cl)c1 |
| InChI | InChI=1S/C11H15ClN2O3S/c1-7(2)11(15)13-14-18(16,17)10-5-4-8(3)6-9(10)12/h4-7,14H,1-3H3,(H,13,15) |
| InChIKey | HDSDOFMCPQMENH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.77 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|