C15H16ClN3O3S — CID 24819123
1-(2-chlorophenyl)-3-[(2,5-dimethylphenyl)sulfonylamino]urea (PubChem CID 24819123) has the molecular formula C15H16ClN3O3S and a molecular weight of 353.83 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[(2,5-dimethylphenyl)sulfonylamino]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[(2,5-dimethylphenyl)sulfonylamino]urea |
|---|---|
| PubChem CID | 24819123 |
| Molecular Formula | C15H16ClN3O3S |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[(2,5-dimethylphenyl)sulfonylamino]urea |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NNC(=O)Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C15H16ClN3O3S/c1-10-7-8-11(2)14(9-10)23(21,22)19-18-15(20)17-13-6-4-3-5-12(13)16/h3-9,19H,1-2H3,(H2,17,18,20) |
| InChIKey | SFAGQTVRERNIRP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|