C21H18Cl2N2O3S — CID 2333532
N-(3,5-dichlorophenyl)-2-[(2,5-dimethylphenyl)sulfonylamino]benzamide (PubChem CID 2333532) has the molecular formula C21H18Cl2N2O3S and a molecular weight of 449.36 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-[(2,5-dimethylphenyl)sulfonylamino]benzamide.
| Compound Name | N-(3,5-dichlorophenyl)-2-[(2,5-dimethylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 2333532 |
| Molecular Formula | C21H18Cl2N2O3S |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-[(2,5-dimethylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Nc2ccccc2C(=O)Nc2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C21H18Cl2N2O3S/c1-13-7-8-14(2)20(9-13)29(27,28)25-19-6-4-3-5-18(19)21(26)24-17-11-15(22)10-16(23)12-17/h3-12,25H,1-2H3,(H,24,26) |
| InChIKey | SMZREUJKQIUVKG-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |