C16H19N3O5S2 — CID 8523585
N-[4-[[(2,5-dimethylphenyl)sulfonylamino]sulfamoyl]phenyl]acetamide (PubChem CID 8523585) has the molecular formula C16H19N3O5S2 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-[4-[[(2,5-dimethylphenyl)sulfonylamino]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[(2,5-dimethylphenyl)sulfonylamino]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 8523585 |
| Molecular Formula | C16H19N3O5S2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | N-[4-[[(2,5-dimethylphenyl)sulfonylamino]sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NNS(=O)(=O)c2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C16H19N3O5S2/c1-11-4-5-12(2)16(10-11)26(23,24)19-18-25(21,22)15-8-6-14(7-9-15)17-13(3)20/h4-10,18-19H,1-3H3,(H,17,20) |
| InChIKey | BYJGFNCYXVYFJZ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|