C14H20ClNO4S — CID 80998367
tert-butyl (2R)-2-[(2-chloro-4-methylphenyl)sulfonylamino]propanoate (PubChem CID 80998367) has the molecular formula C14H20ClNO4S and a molecular weight of 333.84 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(2-chloro-4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | tert-butyl (2R)-2-[(2-chloro-4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 80998367 |
| Molecular Formula | C14H20ClNO4S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | tert-butyl (2R)-2-[(2-chloro-4-methylphenyl)sulfonylamino]propanoate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](C)C(=O)OC(C)(C)C)c(Cl)c1 |
| InChI | InChI=1S/C14H20ClNO4S/c1-9-6-7-12(11(15)8-9)21(18,19)16-10(2)13(17)20-14(3,4)5/h6-8,10,16H,1-5H3/t10-/m1/s1 |
| InChIKey | LBZZEFRGSYYWEN-SNVBAGLBSA-N |
| XLogP | 2.66 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |