C13H18ClNO5S — CID 43619283
2-[(4-chloro-2-methoxyphenyl)sulfonylamino]-2-methylpentanoic acid (PubChem CID 43619283) has the molecular formula C13H18ClNO5S and a molecular weight of 335.81 g/mol. Its IUPAC name is 2-[(4-chloro-2-methoxyphenyl)sulfonylamino]-2-methylpentanoic acid.
| Compound Name | 2-[(4-chloro-2-methoxyphenyl)sulfonylamino]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 43619283 |
| Molecular Formula | C13H18ClNO5S |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 2-[(4-chloro-2-methoxyphenyl)sulfonylamino]-2-methylpentanoic acid |
| SMILES | CCCC(C)(NS(=O)(=O)c1ccc(Cl)cc1OC)C(=O)O |
| InChI | InChI=1S/C13H18ClNO5S/c1-4-7-13(2,12(16)17)15-21(18,19)11-6-5-9(14)8-10(11)20-3/h5-6,8,15H,4,7H2,1-3H3,(H,16,17) |
| InChIKey | JUBYGJLRJUAXHP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |