C19H21F3O2Sn — CID 25052880
2,2,2-trifluoroethyl 3-[dimethyl(phenyl)stannyl]-3-phenylpropanoate (PubChem CID 25052880) has the molecular formula C19H21F3O2Sn and a molecular weight of 457.08 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 3-[dimethyl(phenyl)stannyl]-3-phenylpropanoate.
| Compound Name | 2,2,2-trifluoroethyl 3-[dimethyl(phenyl)stannyl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 25052880 |
| Molecular Formula | C19H21F3O2Sn |
| Molecular Weight | 457.08 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | 2,2,2-trifluoroethyl 3-[dimethyl(phenyl)stannyl]-3-phenylpropanoate |
| SMILES | C[Sn](C)(c1ccccc1)C(CC(=O)OCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C11H10F3O2.C6H5.2CH3.Sn/c12-11(13,14)8-16-10(15)7-6-9-4-2-1-3-5-9;1-2-4-6-5-3-1;;;/h1-6H,7-8H2;1-5H;2*1H3; |
| InChIKey | LODIITQPFJQKKI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.08 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |