C15H19F3O2 — CID 59426568
2,2,2-trifluoroethyl 2,2-dimethyl-4-phenylpentanoate (PubChem CID 59426568) has the molecular formula C15H19F3O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2,2-dimethyl-4-phenylpentanoate.
| Compound Name | 2,2,2-trifluoroethyl 2,2-dimethyl-4-phenylpentanoate |
|---|---|
| PubChem CID | 59426568 |
| Molecular Formula | C15H19F3O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 2,2,2-trifluoroethyl 2,2-dimethyl-4-phenylpentanoate |
| SMILES | CC(CC(C)(C)C(=O)OCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C15H19F3O2/c1-11(12-7-5-4-6-8-12)9-14(2,3)13(19)20-10-15(16,17)18/h4-8,11H,9-10H2,1-3H3 |
| InChIKey | OTFYRHQELQXAAA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |