C13H14F3NO3 — CID 162404580
2,2,2-trifluoroethyl 2-anilino-2-methyl-3-oxobutanoate (PubChem CID 162404580) has the molecular formula C13H14F3NO3 and a molecular weight of 289.25 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-anilino-2-methyl-3-oxobutanoate.
| Compound Name | 2,2,2-trifluoroethyl 2-anilino-2-methyl-3-oxobutanoate |
|---|---|
| PubChem CID | 162404580 |
| Molecular Formula | C13H14F3NO3 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-anilino-2-methyl-3-oxobutanoate |
| SMILES | CC(=O)C(C)(Nc1ccccc1)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C13H14F3NO3/c1-9(18)12(2,11(19)20-8-13(14,15)16)17-10-6-4-3-5-7-10/h3-7,17H,8H2,1-2H3 |
| InChIKey | XKQQRKVSDFHAHO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|