C18H26O2 — CID 164668614
ethyl 4,4-dimethyl-2-methylidene-6-phenylheptanoate (PubChem CID 164668614) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is ethyl 4,4-dimethyl-2-methylidene-6-phenylheptanoate.
| Compound Name | ethyl 4,4-dimethyl-2-methylidene-6-phenylheptanoate |
|---|---|
| PubChem CID | 164668614 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | ethyl 4,4-dimethyl-2-methylidene-6-phenylheptanoate |
| SMILES | C=C(CC(C)(C)CC(C)c1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C18H26O2/c1-6-20-17(19)15(3)13-18(4,5)12-14(2)16-10-8-7-9-11-16/h7-11,14H,3,6,12-13H2,1-2,4-5H3 |
| InChIKey | GUSHNSFFJFDNAA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|