C19H27NO4 — CID 135035866
[2-ethoxycarbonylprop-2-enyl(1-phenylethyl)amino] 2,2-dimethylpropanoate (PubChem CID 135035866) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is [2-ethoxycarbonylprop-2-enyl(1-phenylethyl)amino] 2,2-dimethylpropanoate.
| Compound Name | [2-ethoxycarbonylprop-2-enyl(1-phenylethyl)amino] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 135035866 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | [2-ethoxycarbonylprop-2-enyl(1-phenylethyl)amino] 2,2-dimethylpropanoate |
| SMILES | C=C(CN(OC(=O)C(C)(C)C)C(C)c1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C19H27NO4/c1-7-23-17(21)14(2)13-20(24-18(22)19(4,5)6)15(3)16-11-9-8-10-12-16/h8-12,15H,2,7,13H2,1,3-6H3 |
| InChIKey | HIQIAMXGXKLTSH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|