C19H27NO3 — CID 162408957
ethyl 7-benzamido-4,4-dimethyl-2-methylideneheptanoate (PubChem CID 162408957) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is ethyl 7-benzamido-4,4-dimethyl-2-methylideneheptanoate.
| Compound Name | ethyl 7-benzamido-4,4-dimethyl-2-methylideneheptanoate |
|---|---|
| PubChem CID | 162408957 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | ethyl 7-benzamido-4,4-dimethyl-2-methylideneheptanoate |
| SMILES | C=C(CC(C)(C)CCCNC(=O)c1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C19H27NO3/c1-5-23-18(22)15(2)14-19(3,4)12-9-13-20-17(21)16-10-7-6-8-11-16/h6-8,10-11H,2,5,9,12-14H2,1,3-4H3,(H,20,21) |
| InChIKey | OJGMOYXDYMJMPR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|