C19H25NO5 — CID 46845578
5-O-tert-butyl 1-O-ethyl (4S)-4-benzamido-2-methylidenepentanedioate (PubChem CID 46845578) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-ethyl (4S)-4-benzamido-2-methylidenepentanedioate.
| Compound Name | 5-O-tert-butyl 1-O-ethyl (4S)-4-benzamido-2-methylidenepentanedioate |
|---|---|
| PubChem CID | 46845578 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 5-O-tert-butyl 1-O-ethyl (4S)-4-benzamido-2-methylidenepentanedioate |
| SMILES | C=C(C[C@H](NC(=O)c1ccccc1)C(=O)OC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C19H25NO5/c1-6-24-17(22)13(2)12-15(18(23)25-19(3,4)5)20-16(21)14-10-8-7-9-11-14/h7-11,15H,2,6,12H2,1,3-5H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | ZTXVWUZCVHAHDE-HNNXBMFYSA-N |
| XLogP | 2.64 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|