C16H16F3NO5 — CID 43810994
(Z)-2-benzamido-4-ethoxycarbonyl-6,6,6-trifluorohex-4-enoic acid (PubChem CID 43810994) has the molecular formula C16H16F3NO5 and a molecular weight of 359.30 g/mol. Its IUPAC name is (Z)-2-benzamido-4-ethoxycarbonyl-6,6,6-trifluorohex-4-enoic acid.
| Compound Name | (Z)-2-benzamido-4-ethoxycarbonyl-6,6,6-trifluorohex-4-enoic acid |
|---|---|
| PubChem CID | 43810994 |
| Molecular Formula | C16H16F3NO5 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | (Z)-2-benzamido-4-ethoxycarbonyl-6,6,6-trifluorohex-4-enoic acid |
| SMILES | CCOC(=O)/C(=C\C(F)(F)F)CC(NC(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H16F3NO5/c1-2-25-15(24)11(9-16(17,18)19)8-12(14(22)23)20-13(21)10-6-4-3-5-7-10/h3-7,9,12H,2,8H2,1H3,(H,20,21)(H,22,23)/b11-9- |
| InChIKey | YKMKJFBRMXJXGG-LUAWRHEFSA-N |
| XLogP | 2.31 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|