C10H10Cl2F4Si — CID 154335354
dichloro-phenyl-(3,3,4,4-tetrafluorobutyl)silane (PubChem CID 154335354) has the molecular formula C10H10Cl2F4Si and a molecular weight of 305.17 g/mol. Its IUPAC name is dichloro-phenyl-(3,3,4,4-tetrafluorobutyl)silane.
| Compound Name | dichloro-phenyl-(3,3,4,4-tetrafluorobutyl)silane |
|---|---|
| PubChem CID | 154335354 |
| Molecular Formula | C10H10Cl2F4Si |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | dichloro-phenyl-(3,3,4,4-tetrafluorobutyl)silane |
| SMILES | FC(F)C(F)(F)CC[Si](Cl)(Cl)c1ccccc1 |
| InChI | InChI=1S/C10H10Cl2F4Si/c11-17(12,8-4-2-1-3-5-8)7-6-10(15,16)9(13)14/h1-5,9H,6-7H2 |
| InChIKey | BWFMWTZROYHBBE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|