C4H5Cl3F4Si — CID 144984991
trichloro(3,3,4,4-tetrafluorobutyl)silane (PubChem CID 144984991) has the molecular formula C4H5Cl3F4Si and a molecular weight of 263.52 g/mol. Its IUPAC name is trichloro(3,3,4,4-tetrafluorobutyl)silane.
| Compound Name | trichloro(3,3,4,4-tetrafluorobutyl)silane |
|---|---|
| PubChem CID | 144984991 |
| Molecular Formula | C4H5Cl3F4Si |
| Molecular Weight | 263.52 g/mol |
| Exact Mass | 261.92 |
| IUPAC Name | trichloro(3,3,4,4-tetrafluorobutyl)silane |
| SMILES | FC(F)C(F)(F)CC[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C4H5Cl3F4Si/c5-12(6,7)2-1-4(10,11)3(8)9/h3H,1-2H2 |
| InChIKey | LUWHUXXFHFNIPX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|