C13H9F4NO3 — CID 106765779
1-(2,2,3,3-tetrafluoropropoxy)isoquinoline-4-carboxylic acid (PubChem CID 106765779) has the molecular formula C13H9F4NO3 and a molecular weight of 303.21 g/mol. Its IUPAC name is 1-(2,2,3,3-tetrafluoropropoxy)isoquinoline-4-carboxylic acid.
| Compound Name | 1-(2,2,3,3-tetrafluoropropoxy)isoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 106765779 |
| Molecular Formula | C13H9F4NO3 |
| Molecular Weight | 303.21 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 1-(2,2,3,3-tetrafluoropropoxy)isoquinoline-4-carboxylic acid |
| SMILES | O=C(O)c1cnc(OCC(F)(F)C(F)F)c2ccccc12 |
| InChI | InChI=1S/C13H9F4NO3/c14-12(15)13(16,17)6-21-10-8-4-2-1-3-7(8)9(5-18-10)11(19)20/h1-5,12H,6H2,(H,19,20) |
| InChIKey | BSTCRBRKUYCRBZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.21 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|