C12H11ClF4O5S — CID 23505219
2-chloro-4-ethylsulfonyl-3-(2,2,3,3-tetrafluoropropoxy)benzoic acid (PubChem CID 23505219) has the molecular formula C12H11ClF4O5S and a molecular weight of 378.73 g/mol. Its IUPAC name is 2-chloro-4-ethylsulfonyl-3-(2,2,3,3-tetrafluoropropoxy)benzoic acid.
| Compound Name | 2-chloro-4-ethylsulfonyl-3-(2,2,3,3-tetrafluoropropoxy)benzoic acid |
|---|---|
| PubChem CID | 23505219 |
| Molecular Formula | C12H11ClF4O5S |
| Molecular Weight | 378.73 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | 2-chloro-4-ethylsulfonyl-3-(2,2,3,3-tetrafluoropropoxy)benzoic acid |
| SMILES | CCS(=O)(=O)c1ccc(C(=O)O)c(Cl)c1OCC(F)(F)C(F)F |
| InChI | InChI=1S/C12H11ClF4O5S/c1-2-23(20,21)7-4-3-6(10(18)19)8(13)9(7)22-5-12(16,17)11(14)15/h3-4,11H,2,5H2,1H3,(H,18,19) |
| InChIKey | IHMJGLGKMWGVFU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.73 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|