C11H13ClO6S — CID 18974775
2-chloro-3-(dimethoxymethyl)-4-methylsulfonylbenzoic acid (PubChem CID 18974775) has the molecular formula C11H13ClO6S and a molecular weight of 308.74 g/mol. Its IUPAC name is 2-chloro-3-(dimethoxymethyl)-4-methylsulfonylbenzoic acid.
| Compound Name | 2-chloro-3-(dimethoxymethyl)-4-methylsulfonylbenzoic acid |
|---|---|
| PubChem CID | 18974775 |
| Molecular Formula | C11H13ClO6S |
| Molecular Weight | 308.74 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 2-chloro-3-(dimethoxymethyl)-4-methylsulfonylbenzoic acid |
| SMILES | COC(OC)c1c(S(C)(=O)=O)ccc(C(=O)O)c1Cl |
| InChI | InChI=1S/C11H13ClO6S/c1-17-11(18-2)8-7(19(3,15)16)5-4-6(9(8)12)10(13)14/h4-5,11H,1-3H3,(H,13,14) |
| InChIKey | BKOGLKQEZNYAHT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.74 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|