C13H17ClN2O5S — CID 139329905
2-chloro-3-[[[(E)-N-methoxy-C-methylcarbonimidoyl]-methylamino]methyl]-4-methylsulfonylbenzoic acid (PubChem CID 139329905) has the molecular formula C13H17ClN2O5S and a molecular weight of 348.81 g/mol. Its IUPAC name is 2-chloro-3-[[[(E)-N-methoxy-C-methylcarbonimidoyl]-methylamino]methyl]-4-methylsulfonylbenzoic acid.
| Compound Name | 2-chloro-3-[[[(E)-N-methoxy-C-methylcarbonimidoyl]-methylamino]methyl]-4-methylsulfonylbenzoic acid |
|---|---|
| PubChem CID | 139329905 |
| Molecular Formula | C13H17ClN2O5S |
| Molecular Weight | 348.81 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 2-chloro-3-[[[(E)-N-methoxy-C-methylcarbonimidoyl]-methylamino]methyl]-4-methylsulfonylbenzoic acid |
| SMILES | CO/N=C(\C)N(C)Cc1c(S(C)(=O)=O)ccc(C(=O)O)c1Cl |
| InChI | InChI=1S/C13H17ClN2O5S/c1-8(15-21-3)16(2)7-10-11(22(4,19)20)6-5-9(12(10)14)13(17)18/h5-6H,7H2,1-4H3,(H,17,18)/b15-8+ |
| InChIKey | FGMOVQYQQAXSMX-OVCLIPMQSA-N |
| XLogP | 1.85 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.81 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|