C12H12Cl2N2O4S — CID 149137803
3-[[(3-amino-2-chloroprop-2-enylidene)amino]methyl]-2-chloro-4-methylsulfonylbenzoic acid (PubChem CID 149137803) has the molecular formula C12H12Cl2N2O4S and a molecular weight of 351.21 g/mol. Its IUPAC name is 3-[[(3-amino-2-chloroprop-2-enylidene)amino]methyl]-2-chloro-4-methylsulfonylbenzoic acid.
| Compound Name | 3-[[(3-amino-2-chloroprop-2-enylidene)amino]methyl]-2-chloro-4-methylsulfonylbenzoic acid |
|---|---|
| PubChem CID | 149137803 |
| Molecular Formula | C12H12Cl2N2O4S |
| Molecular Weight | 351.21 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 3-[[(3-amino-2-chloroprop-2-enylidene)amino]methyl]-2-chloro-4-methylsulfonylbenzoic acid |
| SMILES | CS(=O)(=O)c1ccc(C(=O)O)c(Cl)c1C/N=C/C(Cl)=CN |
| InChI | InChI=1S/C12H12Cl2N2O4S/c1-21(19,20)10-3-2-8(12(17)18)11(14)9(10)6-16-5-7(13)4-15/h2-5H,6,15H2,1H3,(H,17,18)/b7-4?,16-5+ |
| InChIKey | JYRRFODRPNOESM-ILPJVPSSSA-N |
| XLogP | 2.05 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|