C11H8ClF5O5S2 — CID 176825730
2-chloro-4-methylsulfonyl-3-(2,2,3,3,3-pentafluoropropylsulfinyl)benzoic acid (PubChem CID 176825730) has the molecular formula C11H8ClF5O5S2 and a molecular weight of 414.76 g/mol. Its IUPAC name is 2-chloro-4-methylsulfonyl-3-(2,2,3,3,3-pentafluoropropylsulfinyl)benzoic acid.
| Compound Name | 2-chloro-4-methylsulfonyl-3-(2,2,3,3,3-pentafluoropropylsulfinyl)benzoic acid |
|---|---|
| PubChem CID | 176825730 |
| Molecular Formula | C11H8ClF5O5S2 |
| Molecular Weight | 414.76 g/mol |
| Exact Mass | 413.94 |
| IUPAC Name | 2-chloro-4-methylsulfonyl-3-(2,2,3,3,3-pentafluoropropylsulfinyl)benzoic acid |
| SMILES | CS(=O)(=O)c1ccc(C(=O)O)c(Cl)c1S(=O)CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H8ClF5O5S2/c1-24(21,22)6-3-2-5(9(18)19)7(12)8(6)23(20)4-10(13,14)11(15,16)17/h2-3H,4H2,1H3,(H,18,19) |
| InChIKey | VMNSEPWCMRPFMQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.76 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|