C12H15ClO6S2 — CID 176825748
3-butan-2-ylsulfonyl-2-chloro-4-methylsulfonylbenzoic acid (PubChem CID 176825748) has the molecular formula C12H15ClO6S2 and a molecular weight of 354.83 g/mol. Its IUPAC name is 3-butan-2-ylsulfonyl-2-chloro-4-methylsulfonylbenzoic acid.
| Compound Name | 3-butan-2-ylsulfonyl-2-chloro-4-methylsulfonylbenzoic acid |
|---|---|
| PubChem CID | 176825748 |
| Molecular Formula | C12H15ClO6S2 |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 3-butan-2-ylsulfonyl-2-chloro-4-methylsulfonylbenzoic acid |
| SMILES | CCC(C)S(=O)(=O)c1c(S(C)(=O)=O)ccc(C(=O)O)c1Cl |
| InChI | InChI=1S/C12H15ClO6S2/c1-4-7(2)21(18,19)11-9(20(3,16)17)6-5-8(10(11)13)12(14)15/h5-7H,4H2,1-3H3,(H,14,15) |
| InChIKey | HFLZTJIDRMLUTK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |