C12H12F4O4 — CID 140720857
3-methoxy-2-methyl-4-(2,2,3,3-tetrafluoropropoxy)benzoic acid (PubChem CID 140720857) has the molecular formula C12H12F4O4 and a molecular weight of 296.22 g/mol. Its IUPAC name is 3-methoxy-2-methyl-4-(2,2,3,3-tetrafluoropropoxy)benzoic acid.
| Compound Name | 3-methoxy-2-methyl-4-(2,2,3,3-tetrafluoropropoxy)benzoic acid |
|---|---|
| PubChem CID | 140720857 |
| Molecular Formula | C12H12F4O4 |
| Molecular Weight | 296.22 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 3-methoxy-2-methyl-4-(2,2,3,3-tetrafluoropropoxy)benzoic acid |
| SMILES | COc1c(OCC(F)(F)C(F)F)ccc(C(=O)O)c1C |
| InChI | InChI=1S/C12H12F4O4/c1-6-7(10(17)18)3-4-8(9(6)19-2)20-5-12(15,16)11(13)14/h3-4,11H,5H2,1-2H3,(H,17,18) |
| InChIKey | IQCCXJXFCQZZOQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.22 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|