3-methoxy-2-methyl-4-(2,2,3,3-tetrafluoropropoxy)benzoic acid

C12H12F4O4 — CID 140720857

IUPAC3-methoxy-2-methyl-4-(2,2,3,3-tetrafluoropropoxy)benzoic acid
SMILESCOc1c(OCC(F)(F)C(F)F)ccc(C(=O)O)c1C
InChIInChI=1S/C12H12F4O4/c1-6-7(10(17)18)3-4-8(9(6)19-2)20-5-12(15,16)11(13)14/h3-4,11H,5H2,1-2H3,(H,17,18)
InChIKeyIQCCXJXFCQZZOQ-UHFFFAOYSA-N
MW296.22 g/mol
LogP2.98
Rot. Bonds6

About 3-methoxy-2-methyl-4-(2,2,3,3-tetrafluoropropoxy)benzoic acid

3-methoxy-2-methyl-4-(2,2,3,3-tetrafluoropropoxy)benzoic acid (PubChem CID 140720857) has the molecular formula C12H12F4O4 and a molecular weight of 296.22 g/mol. Its IUPAC name is 3-methoxy-2-methyl-4-(2,2,3,3-tetrafluoropropoxy)benzoic acid.

Molecular Properties

Compound Name3-methoxy-2-methyl-4-(2,2,3,3-tetrafluoropropoxy)benzoic acid
PubChem CID140720857
Molecular FormulaC12H12F4O4
Molecular Weight296.22 g/mol
Exact Mass296.07
IUPAC Name3-methoxy-2-methyl-4-(2,2,3,3-tetrafluoropropoxy)benzoic acid
SMILESCOc1c(OCC(F)(F)C(F)F)ccc(C(=O)O)c1C
InChIInChI=1S/C12H12F4O4/c1-6-7(10(17)18)3-4-8(9(6)19-2)20-5-12(15,16)11(13)14/h3-4,11H,5H2,1-2H3,(H,17,18)
InChIKeyIQCCXJXFCQZZOQ-UHFFFAOYSA-N
XLogP2.98
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500296.22
LogP ≤ 52.98
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze 3-methoxy-2-methyl-4-(2,2,3,3-tetrafluoropropoxy)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methoxy-2-methyl-4-(2,2,3,3-tetrafluoropropoxy)benzoic acid?
The IUPAC name of 3-methoxy-2-methyl-4-(2,2,3,3-tetrafluoropropoxy)benzoic acid (CID 140720857) is 3-methoxy-2-methyl-4-(2,2,3,3-tetrafluoropropoxy)benzoic acid.
What is the SMILES notation for 3-methoxy-2-methyl-4-(2,2,3,3-tetrafluoropropoxy)benzoic acid?
The canonical SMILES for 3-methoxy-2-methyl-4-(2,2,3,3-tetrafluoropropoxy)benzoic acid is COc1c(OCC(F)(F)C(F)F)ccc(C(=O)O)c1C.
What is the InChIKey of 3-methoxy-2-methyl-4-(2,2,3,3-tetrafluoropropoxy)benzoic acid?
The InChIKey is IQCCXJXFCQZZOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F4O4/c1-6-7(10(17)18)3-4-8(9(6)19-2)20-5-12(15,16)11(13)14/h3-4,11H,5H2,1-2H3,(H,17,18).
What are the key properties of 3-methoxy-2-methyl-4-(2,2,3,3-tetrafluoropropoxy)benzoic acid?
3-methoxy-2-methyl-4-(2,2,3,3-tetrafluoropropoxy)benzoic acid has a molecular weight of 296.22 g/mol, XLogP of 2.98, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-2-methyl-4-(2,2,3,3-tetrafluoropropoxy)benzoic acid is sourced from PubChem (CID 140720857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).