C10H7F3O5 — CID 54088454
2-methoxy-4-(trifluoromethyl)benzene-1,3-dicarboxylic acid (PubChem CID 54088454) has the molecular formula C10H7F3O5 and a molecular weight of 264.15 g/mol. Its IUPAC name is 2-methoxy-4-(trifluoromethyl)benzene-1,3-dicarboxylic acid.
| Compound Name | 2-methoxy-4-(trifluoromethyl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 54088454 |
| Molecular Formula | C10H7F3O5 |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 2-methoxy-4-(trifluoromethyl)benzene-1,3-dicarboxylic acid |
| SMILES | COc1c(C(=O)O)ccc(C(F)(F)F)c1C(=O)O |
| InChI | InChI=1S/C10H7F3O5/c1-18-7-4(8(14)15)2-3-5(10(11,12)13)6(7)9(16)17/h2-3H,1H3,(H,14,15)(H,16,17) |
| InChIKey | MSDRPWJPIXTTGX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |